C19H19BrN4O3 — CID 108836498
(Z)-3-[(4-bromo-2-pyridinyl)amino]-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]prop-2-enamide (PubChem CID 108836498) has the molecular formula C19H19BrN4O3 and a molecular weight of 431.29 g/mol. Its IUPAC name is (Z)-3-[(4-bromo-2-pyridinyl)amino]-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]prop-2-enamide.
| Compound Name | (Z)-3-[(4-bromo-2-pyridinyl)amino]-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 108836498 |
| Molecular Formula | C19H19BrN4O3 |
| Molecular Weight | 431.29 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | (Z)-3-[(4-bromo-2-pyridinyl)amino]-2-cyano-N-[2-(3,4-dimethoxyphenyl)ethyl]prop-2-enamide |
| SMILES | COc1ccc(CCNC(=O)/C(C#N)=C\Nc2cc(Br)ccn2)cc1OC |
| InChI | InChI=1S/C19H19BrN4O3/c1-26-16-4-3-13(9-17(16)27-2)5-7-23-19(25)14(11-21)12-24-18-10-15(20)6-8-22-18/h3-4,6,8-10,12H,5,7H2,1-2H3,(H,22,24)(H,23,25)/b14-12- |
| InChIKey | MJJZZNMEJYEHEA-OWBHPGMISA-N |
| XLogP | 3.04 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|