C12H12BrClN4O — CID 108854337
(Z)-3-[(4-bromo-2-pyridinyl)amino]-N-(3-chloropropyl)-2-cyanoprop-2-enamide (PubChem CID 108854337) has the molecular formula C12H12BrClN4O and a molecular weight of 343.61 g/mol. Its IUPAC name is (Z)-3-[(4-bromo-2-pyridinyl)amino]-N-(3-chloropropyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[(4-bromo-2-pyridinyl)amino]-N-(3-chloropropyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108854337 |
| Molecular Formula | C12H12BrClN4O |
| Molecular Weight | 343.61 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | (Z)-3-[(4-bromo-2-pyridinyl)amino]-N-(3-chloropropyl)-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/Nc1cc(Br)ccn1)C(=O)NCCCCl |
| InChI | InChI=1S/C12H12BrClN4O/c13-10-2-5-16-11(6-10)18-8-9(7-15)12(19)17-4-1-3-14/h2,5-6,8H,1,3-4H2,(H,16,18)(H,17,19)/b9-8- |
| InChIKey | DQQLVGBAWQOHKG-HJWRWDBZSA-N |
| XLogP | 2.41 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.61 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|