C14H15BrClN3O — CID 108854700
(Z)-3-[2-(3-bromophenyl)ethylamino]-N-(2-chloroethyl)-2-cyanoprop-2-enamide (PubChem CID 108854700) has the molecular formula C14H15BrClN3O and a molecular weight of 356.65 g/mol. Its IUPAC name is (Z)-3-[2-(3-bromophenyl)ethylamino]-N-(2-chloroethyl)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[2-(3-bromophenyl)ethylamino]-N-(2-chloroethyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108854700 |
| Molecular Formula | C14H15BrClN3O |
| Molecular Weight | 356.65 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | (Z)-3-[2-(3-bromophenyl)ethylamino]-N-(2-chloroethyl)-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/NCCc1cccc(Br)c1)C(=O)NCCCl |
| InChI | InChI=1S/C14H15BrClN3O/c15-13-3-1-2-11(8-13)4-6-18-10-12(9-17)14(20)19-7-5-16/h1-3,8,10,18H,4-7H2,(H,19,20)/b12-10- |
| InChIKey | WVZODTBFJMVVCB-BENRWUELSA-N |
| XLogP | 2.34 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.65 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|