C19H14BrClF3N3O — CID 108859174
(Z)-3-[2-(3-bromophenyl)ethylamino]-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide (PubChem CID 108859174) has the molecular formula C19H14BrClF3N3O and a molecular weight of 472.69 g/mol. Its IUPAC name is (Z)-3-[2-(3-bromophenyl)ethylamino]-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-[2-(3-bromophenyl)ethylamino]-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108859174 |
| Molecular Formula | C19H14BrClF3N3O |
| Molecular Weight | 472.69 g/mol |
| Exact Mass | 471.00 |
| IUPAC Name | (Z)-3-[2-(3-bromophenyl)ethylamino]-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/NCCc1cccc(Br)c1)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H14BrClF3N3O/c20-14-3-1-2-12(8-14)6-7-26-11-13(10-25)18(28)27-15-4-5-17(21)16(9-15)19(22,23)24/h1-5,8-9,11,26H,6-7H2,(H,27,28)/b13-11- |
| InChIKey | KNDRTZKDUZVOOH-QBFSEMIESA-N |
| XLogP | 5.30 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.69 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|