C17H9Cl3F3N3O — CID 108858844
(Z)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyano-3-(3,4-dichloroanilino)prop-2-enamide (PubChem CID 108858844) has the molecular formula C17H9Cl3F3N3O and a molecular weight of 434.63 g/mol. Its IUPAC name is (Z)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyano-3-(3,4-dichloroanilino)prop-2-enamide.
| Compound Name | (Z)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyano-3-(3,4-dichloroanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108858844 |
| Molecular Formula | C17H9Cl3F3N3O |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 432.98 |
| IUPAC Name | (Z)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyano-3-(3,4-dichloroanilino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc(Cl)c(Cl)c1)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H9Cl3F3N3O/c18-13-3-2-11(5-12(13)17(21,22)23)26-16(27)9(7-24)8-25-10-1-4-14(19)15(20)6-10/h1-6,8,25H,(H,26,27)/b9-8- |
| InChIKey | SFFWHUCUFKQOOW-HJWRWDBZSA-N |
| XLogP | 6.12 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|