C19H15ClF3N3O2 — CID 108855589
(Z)-3-[4-chloro-3-(trifluoromethyl)anilino]-2-cyano-N-(4-ethoxyphenyl)prop-2-enamide (PubChem CID 108855589) has the molecular formula C19H15ClF3N3O2 and a molecular weight of 409.80 g/mol. Its IUPAC name is (Z)-3-[4-chloro-3-(trifluoromethyl)anilino]-2-cyano-N-(4-ethoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[4-chloro-3-(trifluoromethyl)anilino]-2-cyano-N-(4-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108855589 |
| Molecular Formula | C19H15ClF3N3O2 |
| Molecular Weight | 409.80 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | (Z)-3-[4-chloro-3-(trifluoromethyl)anilino]-2-cyano-N-(4-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(NC(=O)/C(C#N)=C\Nc2ccc(Cl)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H15ClF3N3O2/c1-2-28-15-6-3-13(4-7-15)26-18(27)12(10-24)11-25-14-5-8-17(20)16(9-14)19(21,22)23/h3-9,11,25H,2H2,1H3,(H,26,27)/b12-11- |
| InChIKey | WNHOUGDGIBLVIY-QXMHVHEDSA-N |
| XLogP | 5.22 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.80 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|