C12H8ClF3N2O2 — CID 5208256
methyl 3-[4-chloro-3-(trifluoromethyl)anilino]-2-cyanoprop-2-enoate (PubChem CID 5208256) has the molecular formula C12H8ClF3N2O2 and a molecular weight of 304.66 g/mol. Its IUPAC name is methyl 3-[4-chloro-3-(trifluoromethyl)anilino]-2-cyanoprop-2-enoate.
| Compound Name | methyl 3-[4-chloro-3-(trifluoromethyl)anilino]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 5208256 |
| Molecular Formula | C12H8ClF3N2O2 |
| Molecular Weight | 304.66 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | methyl 3-[4-chloro-3-(trifluoromethyl)anilino]-2-cyanoprop-2-enoate |
| SMILES | COC(=O)C(C#N)=CNc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H8ClF3N2O2/c1-20-11(19)7(5-17)6-18-8-2-3-10(13)9(4-8)12(14,15)16/h2-4,6,18H,1H3 |
| InChIKey | OWQQXEYHSIHKTK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.66 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|