C12H11ClN2O3 — CID 19629030
methyl (Z)-3-(3-chloro-4-methoxyanilino)-2-cyanoprop-2-enoate (PubChem CID 19629030) has the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. Its IUPAC name is methyl (Z)-3-(3-chloro-4-methoxyanilino)-2-cyanoprop-2-enoate.
| Compound Name | methyl (Z)-3-(3-chloro-4-methoxyanilino)-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 19629030 |
| Molecular Formula | C12H11ClN2O3 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | methyl (Z)-3-(3-chloro-4-methoxyanilino)-2-cyanoprop-2-enoate |
| SMILES | COC(=O)/C(C#N)=C\Nc1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C12H11ClN2O3/c1-17-11-4-3-9(5-10(11)13)15-7-8(6-14)12(16)18-2/h3-5,7,15H,1-2H3/b8-7- |
| InChIKey | NSJPGHRWVSJPRH-FPLPWBNLSA-N |
| XLogP | 2.34 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|