C17H10Cl2F3N3O — CID 108858948
(Z)-3-(3-chloroanilino)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide (PubChem CID 108858948) has the molecular formula C17H10Cl2F3N3O and a molecular weight of 400.19 g/mol. Its IUPAC name is (Z)-3-(3-chloroanilino)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide.
| Compound Name | (Z)-3-(3-chloroanilino)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108858948 |
| Molecular Formula | C17H10Cl2F3N3O |
| Molecular Weight | 400.19 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | (Z)-3-(3-chloroanilino)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/Nc1cccc(Cl)c1)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H10Cl2F3N3O/c18-11-2-1-3-12(6-11)24-9-10(8-23)16(26)25-13-4-5-15(19)14(7-13)17(20,21)22/h1-7,9,24H,(H,25,26)/b10-9- |
| InChIKey | WWKGSBBMVAMIGE-KTKRTIGZSA-N |
| XLogP | 5.47 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.19 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|