C21H13ClF3N3O2 — CID 108858901
(Z)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]prop-2-enamide (PubChem CID 108858901) has the molecular formula C21H13ClF3N3O2 and a molecular weight of 431.80 g/mol. Its IUPAC name is (Z)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]prop-2-enamide.
| Compound Name | (Z)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]prop-2-enamide |
|---|---|
| PubChem CID | 108858901 |
| Molecular Formula | C21H13ClF3N3O2 |
| Molecular Weight | 431.80 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | (Z)-N-[4-chloro-3-(trifluoromethyl)phenyl]-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]prop-2-enamide |
| SMILES | N#C/C(=C/Nc1cccc2c(O)cccc12)C(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H13ClF3N3O2/c22-17-8-7-13(9-16(17)21(23,24)25)28-20(30)12(10-26)11-27-18-5-1-4-15-14(18)3-2-6-19(15)29/h1-9,11,27,29H,(H,28,30)/b12-11- |
| InChIKey | KRVGMBRAPVBBNU-QXMHVHEDSA-N |
| XLogP | 5.68 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.80 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|