C20H15N3O5S — CID 108819478
3-[[(Z)-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]prop-2-enoyl]amino]benzenesulfonic acid (PubChem CID 108819478) has the molecular formula C20H15N3O5S and a molecular weight of 409.42 g/mol. Its IUPAC name is 3-[[(Z)-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]prop-2-enoyl]amino]benzenesulfonic acid.
| Compound Name | 3-[[(Z)-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]prop-2-enoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108819478 |
| Molecular Formula | C20H15N3O5S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 3-[[(Z)-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]prop-2-enoyl]amino]benzenesulfonic acid |
| SMILES | N#C/C(=C/Nc1cccc2c(O)cccc12)C(=O)Nc1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C20H15N3O5S/c21-11-13(20(25)23-14-4-1-5-15(10-14)29(26,27)28)12-22-18-8-2-7-17-16(18)6-3-9-19(17)24/h1-10,12,22,24H,(H,23,25)(H,26,27,28)/b13-12- |
| InChIKey | OLMFJHVPWCDQFQ-SEYXRHQNSA-N |
| XLogP | 3.25 |
| TPSA | 139.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|