C17H14N4O5S — CID 108819651
3-[[(Z)-3-(4-carbamoylanilino)-2-cyanoprop-2-enoyl]amino]benzenesulfonic acid (PubChem CID 108819651) has the molecular formula C17H14N4O5S and a molecular weight of 386.39 g/mol. Its IUPAC name is 3-[[(Z)-3-(4-carbamoylanilino)-2-cyanoprop-2-enoyl]amino]benzenesulfonic acid.
| Compound Name | 3-[[(Z)-3-(4-carbamoylanilino)-2-cyanoprop-2-enoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108819651 |
| Molecular Formula | C17H14N4O5S |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 3-[[(Z)-3-(4-carbamoylanilino)-2-cyanoprop-2-enoyl]amino]benzenesulfonic acid |
| SMILES | N#C/C(=C/Nc1ccc(C(N)=O)cc1)C(=O)Nc1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C17H14N4O5S/c18-9-12(10-20-13-6-4-11(5-7-13)16(19)22)17(23)21-14-2-1-3-15(8-14)27(24,25)26/h1-8,10,20H,(H2,19,22)(H,21,23)(H,24,25,26)/b12-10- |
| InChIKey | CEQVPOCCEBZGKJ-BENRWUELSA-N |
| XLogP | 1.49 |
| TPSA | 162.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|