C18H17N3O5S — CID 108819512
3-[[(Z)-2-cyano-3-(4-ethoxyanilino)prop-2-enoyl]amino]benzenesulfonic acid (PubChem CID 108819512) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is 3-[[(Z)-2-cyano-3-(4-ethoxyanilino)prop-2-enoyl]amino]benzenesulfonic acid.
| Compound Name | 3-[[(Z)-2-cyano-3-(4-ethoxyanilino)prop-2-enoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108819512 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 3-[[(Z)-2-cyano-3-(4-ethoxyanilino)prop-2-enoyl]amino]benzenesulfonic acid |
| SMILES | CCOc1ccc(N/C=C(/C#N)C(=O)Nc2cccc(S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C18H17N3O5S/c1-2-26-16-8-6-14(7-9-16)20-12-13(11-19)18(22)21-15-4-3-5-17(10-15)27(23,24)25/h3-10,12,20H,2H2,1H3,(H,21,22)(H,23,24,25)/b13-12- |
| InChIKey | VDVCYSBAVOZNSW-SEYXRHQNSA-N |
| XLogP | 2.79 |
| TPSA | 128.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|