C20H21N3O4S — CID 108819423
3-[[(Z)-2-cyano-3-(2-methyl-6-propan-2-ylanilino)prop-2-enoyl]amino]benzenesulfonic acid (PubChem CID 108819423) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is 3-[[(Z)-2-cyano-3-(2-methyl-6-propan-2-ylanilino)prop-2-enoyl]amino]benzenesulfonic acid.
| Compound Name | 3-[[(Z)-2-cyano-3-(2-methyl-6-propan-2-ylanilino)prop-2-enoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108819423 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 3-[[(Z)-2-cyano-3-(2-methyl-6-propan-2-ylanilino)prop-2-enoyl]amino]benzenesulfonic acid |
| SMILES | Cc1cccc(C(C)C)c1N/C=C(/C#N)C(=O)Nc1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C20H21N3O4S/c1-13(2)18-9-4-6-14(3)19(18)22-12-15(11-21)20(24)23-16-7-5-8-17(10-16)28(25,26)27/h4-10,12-13,22H,1-3H3,(H,23,24)(H,25,26,27)/b15-12- |
| InChIKey | XTPWXMGOMCVBMD-QINSGFPZSA-N |
| XLogP | 3.82 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|