C23H27N3O — CID 108822483
(Z)-2-cyano-N-(2-methyl-6-propan-2-ylphenyl)-3-(2,4,6-trimethylanilino)prop-2-enamide (PubChem CID 108822483) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2-methyl-6-propan-2-ylphenyl)-3-(2,4,6-trimethylanilino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2-methyl-6-propan-2-ylphenyl)-3-(2,4,6-trimethylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108822483 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | (Z)-2-cyano-N-(2-methyl-6-propan-2-ylphenyl)-3-(2,4,6-trimethylanilino)prop-2-enamide |
| SMILES | Cc1cc(C)c(N/C=C(/C#N)C(=O)Nc2c(C)cccc2C(C)C)c(C)c1 |
| InChI | InChI=1S/C23H27N3O/c1-14(2)20-9-7-8-16(4)22(20)26-23(27)19(12-24)13-25-21-17(5)10-15(3)11-18(21)6/h7-11,13-14,25H,1-6H3,(H,26,27)/b19-13- |
| InChIKey | CGTQRYCSPHIGNG-UYRXBGFRSA-N |
| XLogP | 5.50 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|