C24H23N3O2 — CID 108822461
(Z)-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]-N-(2-methyl-6-propan-2-ylphenyl)prop-2-enamide (PubChem CID 108822461) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is (Z)-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]-N-(2-methyl-6-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]-N-(2-methyl-6-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108822461 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (Z)-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]-N-(2-methyl-6-propan-2-ylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)/C(C#N)=C\Nc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C24H23N3O2/c1-15(2)18-8-4-7-16(3)23(18)27-24(29)17(13-25)14-26-21-11-5-10-20-19(21)9-6-12-22(20)28/h4-12,14-15,26,28H,1-3H3,(H,27,29)/b17-14- |
| InChIKey | MYEFLFMPUBABHV-VKAVYKQESA-N |
| XLogP | 5.44 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|