C21H22ClN3O — CID 108849906
(Z)-N-(5-chloro-2-methylphenyl)-2-cyano-3-(2-methyl-6-propan-2-ylanilino)prop-2-enamide (PubChem CID 108849906) has the molecular formula C21H22ClN3O and a molecular weight of 367.88 g/mol. Its IUPAC name is (Z)-N-(5-chloro-2-methylphenyl)-2-cyano-3-(2-methyl-6-propan-2-ylanilino)prop-2-enamide.
| Compound Name | (Z)-N-(5-chloro-2-methylphenyl)-2-cyano-3-(2-methyl-6-propan-2-ylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108849906 |
| Molecular Formula | C21H22ClN3O |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (Z)-N-(5-chloro-2-methylphenyl)-2-cyano-3-(2-methyl-6-propan-2-ylanilino)prop-2-enamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)/C(C#N)=C\Nc1c(C)cccc1C(C)C |
| InChI | InChI=1S/C21H22ClN3O/c1-13(2)18-7-5-6-15(4)20(18)24-12-16(11-23)21(26)25-19-10-17(22)9-8-14(19)3/h5-10,12-13,24H,1-4H3,(H,25,26)/b16-12- |
| InChIKey | NZLMMFVSLCKQNC-VBKFSLOCSA-N |
| XLogP | 5.54 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|