C16H13N3O5S — CID 108819511
3-[[(Z)-2-cyano-3-(2-hydroxyanilino)prop-2-enoyl]amino]benzenesulfonic acid (PubChem CID 108819511) has the molecular formula C16H13N3O5S and a molecular weight of 359.36 g/mol. Its IUPAC name is 3-[[(Z)-2-cyano-3-(2-hydroxyanilino)prop-2-enoyl]amino]benzenesulfonic acid.
| Compound Name | 3-[[(Z)-2-cyano-3-(2-hydroxyanilino)prop-2-enoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108819511 |
| Molecular Formula | C16H13N3O5S |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 3-[[(Z)-2-cyano-3-(2-hydroxyanilino)prop-2-enoyl]amino]benzenesulfonic acid |
| SMILES | N#C/C(=C/Nc1ccccc1O)C(=O)Nc1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C16H13N3O5S/c17-9-11(10-18-14-6-1-2-7-15(14)20)16(21)19-12-4-3-5-13(8-12)25(22,23)24/h1-8,10,18,20H,(H,19,21)(H,22,23,24)/b11-10- |
| InChIKey | BTDDMTIHGVNSCY-KHPPLWFESA-N |
| XLogP | 2.10 |
| TPSA | 139.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|