C16H11ClN4O6S — CID 108819507
3-[[(Z)-3-(2-chloro-5-nitroanilino)-2-cyanoprop-2-enoyl]amino]benzenesulfonic acid (PubChem CID 108819507) has the molecular formula C16H11ClN4O6S and a molecular weight of 422.81 g/mol. Its IUPAC name is 3-[[(Z)-3-(2-chloro-5-nitroanilino)-2-cyanoprop-2-enoyl]amino]benzenesulfonic acid.
| Compound Name | 3-[[(Z)-3-(2-chloro-5-nitroanilino)-2-cyanoprop-2-enoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108819507 |
| Molecular Formula | C16H11ClN4O6S |
| Molecular Weight | 422.81 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | 3-[[(Z)-3-(2-chloro-5-nitroanilino)-2-cyanoprop-2-enoyl]amino]benzenesulfonic acid |
| SMILES | N#C/C(=C/Nc1cc([N+](=O)[O-])ccc1Cl)C(=O)Nc1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C16H11ClN4O6S/c17-14-5-4-12(21(23)24)7-15(14)19-9-10(8-18)16(22)20-11-2-1-3-13(6-11)28(25,26)27/h1-7,9,19H,(H,20,22)(H,25,26,27)/b10-9- |
| InChIKey | DVNPXZCYISHJIV-KTKRTIGZSA-N |
| XLogP | 2.95 |
| TPSA | 162.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.81 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|