C16H11Cl2N3O4S — CID 108825380
3-[[(Z)-2-cyano-3-(2,5-dichloroanilino)-3-oxoprop-1-enyl]amino]benzenesulfonic acid (PubChem CID 108825380) has the molecular formula C16H11Cl2N3O4S and a molecular weight of 412.25 g/mol. Its IUPAC name is 3-[[(Z)-2-cyano-3-(2,5-dichloroanilino)-3-oxoprop-1-enyl]amino]benzenesulfonic acid.
| Compound Name | 3-[[(Z)-2-cyano-3-(2,5-dichloroanilino)-3-oxoprop-1-enyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108825380 |
| Molecular Formula | C16H11Cl2N3O4S |
| Molecular Weight | 412.25 g/mol |
| Exact Mass | 410.98 |
| IUPAC Name | 3-[[(Z)-2-cyano-3-(2,5-dichloroanilino)-3-oxoprop-1-enyl]amino]benzenesulfonic acid |
| SMILES | N#C/C(=C/Nc1cccc(S(=O)(=O)O)c1)C(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H11Cl2N3O4S/c17-11-4-5-14(18)15(6-11)21-16(22)10(8-19)9-20-12-2-1-3-13(7-12)26(23,24)25/h1-7,9,20H,(H,21,22)(H,23,24,25)/b10-9- |
| InChIKey | DEXNFSKYQAYXEN-KTKRTIGZSA-N |
| XLogP | 3.70 |
| TPSA | 119.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|