C16H14N4O4S — CID 108819038
4-[[(Z)-3-(4-aminoanilino)-2-cyanoprop-2-enoyl]amino]benzenesulfonic acid (PubChem CID 108819038) has the molecular formula C16H14N4O4S and a molecular weight of 358.38 g/mol. Its IUPAC name is 4-[[(Z)-3-(4-aminoanilino)-2-cyanoprop-2-enoyl]amino]benzenesulfonic acid.
| Compound Name | 4-[[(Z)-3-(4-aminoanilino)-2-cyanoprop-2-enoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108819038 |
| Molecular Formula | C16H14N4O4S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 4-[[(Z)-3-(4-aminoanilino)-2-cyanoprop-2-enoyl]amino]benzenesulfonic acid |
| SMILES | N#C/C(=C/Nc1ccc(N)cc1)C(=O)Nc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C16H14N4O4S/c17-9-11(10-19-13-3-1-12(18)2-4-13)16(21)20-14-5-7-15(8-6-14)25(22,23)24/h1-8,10,19H,18H2,(H,20,21)(H,22,23,24)/b11-10- |
| InChIKey | YBBFQIWROFOPCC-KHPPLWFESA-N |
| XLogP | 1.97 |
| TPSA | 145.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|