C17H15BrN4O — CID 108818217
(Z)-N-(4-aminophenyl)-3-(4-bromo-3-methylanilino)-2-cyanoprop-2-enamide (PubChem CID 108818217) has the molecular formula C17H15BrN4O and a molecular weight of 371.24 g/mol. Its IUPAC name is (Z)-N-(4-aminophenyl)-3-(4-bromo-3-methylanilino)-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-(4-aminophenyl)-3-(4-bromo-3-methylanilino)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108818217 |
| Molecular Formula | C17H15BrN4O |
| Molecular Weight | 371.24 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | (Z)-N-(4-aminophenyl)-3-(4-bromo-3-methylanilino)-2-cyanoprop-2-enamide |
| SMILES | Cc1cc(N/C=C(/C#N)C(=O)Nc2ccc(N)cc2)ccc1Br |
| InChI | InChI=1S/C17H15BrN4O/c1-11-8-15(6-7-16(11)18)21-10-12(9-19)17(23)22-14-4-2-13(20)3-5-14/h2-8,10,21H,20H2,1H3,(H,22,23)/b12-10- |
| InChIKey | LEQZHQPECRTCRX-BENRWUELSA-N |
| XLogP | 3.80 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.24 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|