C17H16N4OS — CID 108818057
(Z)-N-(4-aminophenyl)-2-cyano-3-(3-methylsulfanylanilino)prop-2-enamide (PubChem CID 108818057) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is (Z)-N-(4-aminophenyl)-2-cyano-3-(3-methylsulfanylanilino)prop-2-enamide.
| Compound Name | (Z)-N-(4-aminophenyl)-2-cyano-3-(3-methylsulfanylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108818057 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (Z)-N-(4-aminophenyl)-2-cyano-3-(3-methylsulfanylanilino)prop-2-enamide |
| SMILES | CSc1cccc(N/C=C(/C#N)C(=O)Nc2ccc(N)cc2)c1 |
| InChI | InChI=1S/C17H16N4OS/c1-23-16-4-2-3-15(9-16)20-11-12(10-18)17(22)21-14-7-5-13(19)6-8-14/h2-9,11,20H,19H2,1H3,(H,21,22)/b12-11- |
| InChIKey | UKUHMCBCIVQVII-QXMHVHEDSA-N |
| XLogP | 3.45 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|