C19H16N4O4 — CID 108818291
3-[[(Z)-3-(4-acetamidoanilino)-2-cyano-3-oxoprop-1-enyl]amino]benzoic acid (PubChem CID 108818291) has the molecular formula C19H16N4O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is 3-[[(Z)-3-(4-acetamidoanilino)-2-cyano-3-oxoprop-1-enyl]amino]benzoic acid.
| Compound Name | 3-[[(Z)-3-(4-acetamidoanilino)-2-cyano-3-oxoprop-1-enyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108818291 |
| Molecular Formula | C19H16N4O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 3-[[(Z)-3-(4-acetamidoanilino)-2-cyano-3-oxoprop-1-enyl]amino]benzoic acid |
| SMILES | CC(=O)Nc1ccc(NC(=O)/C(C#N)=C\Nc2cccc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C19H16N4O4/c1-12(24)22-15-5-7-16(8-6-15)23-18(25)14(10-20)11-21-17-4-2-3-13(9-17)19(26)27/h2-9,11,21H,1H3,(H,22,24)(H,23,25)(H,26,27)/b14-11- |
| InChIKey | YKVHMHKRIVMSHE-KAMYIIQDSA-N |
| XLogP | 2.80 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|