C17H12N4O5 — CID 108852863
3-[[(Z)-2-cyano-3-(4-nitroanilino)-3-oxoprop-1-enyl]amino]benzoic acid (PubChem CID 108852863) has the molecular formula C17H12N4O5 and a molecular weight of 352.31 g/mol. Its IUPAC name is 3-[[(Z)-2-cyano-3-(4-nitroanilino)-3-oxoprop-1-enyl]amino]benzoic acid.
| Compound Name | 3-[[(Z)-2-cyano-3-(4-nitroanilino)-3-oxoprop-1-enyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108852863 |
| Molecular Formula | C17H12N4O5 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 3-[[(Z)-2-cyano-3-(4-nitroanilino)-3-oxoprop-1-enyl]amino]benzoic acid |
| SMILES | N#C/C(=C/Nc1cccc(C(=O)O)c1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H12N4O5/c18-9-12(10-19-14-3-1-2-11(8-14)17(23)24)16(22)20-13-4-6-15(7-5-13)21(25)26/h1-8,10,19H,(H,20,22)(H,23,24)/b12-10- |
| InChIKey | HPEGWVFKUMZBTP-BENRWUELSA-N |
| XLogP | 2.75 |
| TPSA | 145.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|