C21H15N3O4 — CID 108842806
3-[[(Z)-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]-3-oxoprop-1-enyl]amino]benzoic acid (PubChem CID 108842806) has the molecular formula C21H15N3O4 and a molecular weight of 373.37 g/mol. Its IUPAC name is 3-[[(Z)-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]-3-oxoprop-1-enyl]amino]benzoic acid.
| Compound Name | 3-[[(Z)-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]-3-oxoprop-1-enyl]amino]benzoic acid |
|---|---|
| PubChem CID | 108842806 |
| Molecular Formula | C21H15N3O4 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 3-[[(Z)-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]-3-oxoprop-1-enyl]amino]benzoic acid |
| SMILES | N#C/C(=C/Nc1cccc(C(=O)O)c1)C(=O)Nc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C21H15N3O4/c22-11-14(12-23-15-5-1-4-13(10-15)21(27)28)20(26)24-18-8-2-7-17-16(18)6-3-9-19(17)25/h1-10,12,23,25H,(H,24,26)(H,27,28)/b14-12- |
| InChIKey | KPMBQLFXNMRPAV-OWBHPGMISA-N |
| XLogP | 3.70 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|