C22H19N3O2 — CID 108843063
(Z)-2-cyano-3-(3,5-dimethylanilino)-N-(5-hydroxynaphthalen-1-yl)prop-2-enamide (PubChem CID 108843063) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3,5-dimethylanilino)-N-(5-hydroxynaphthalen-1-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(3,5-dimethylanilino)-N-(5-hydroxynaphthalen-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108843063 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | (Z)-2-cyano-3-(3,5-dimethylanilino)-N-(5-hydroxynaphthalen-1-yl)prop-2-enamide |
| SMILES | Cc1cc(C)cc(N/C=C(/C#N)C(=O)Nc2cccc3c(O)cccc23)c1 |
| InChI | InChI=1S/C22H19N3O2/c1-14-9-15(2)11-17(10-14)24-13-16(12-23)22(27)25-20-7-3-6-19-18(20)5-4-8-21(19)26/h3-11,13,24,26H,1-2H3,(H,25,27)/b16-13- |
| InChIKey | YILSYYLULFWBEP-SSZFMOIBSA-N |
| XLogP | 4.62 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|