C19H13BrN4O2 — CID 108843158
(Z)-3-[(5-bromo-2-pyridinyl)amino]-2-cyano-N-(5-hydroxynaphthalen-1-yl)prop-2-enamide (PubChem CID 108843158) has the molecular formula C19H13BrN4O2 and a molecular weight of 409.24 g/mol. Its IUPAC name is (Z)-3-[(5-bromo-2-pyridinyl)amino]-2-cyano-N-(5-hydroxynaphthalen-1-yl)prop-2-enamide.
| Compound Name | (Z)-3-[(5-bromo-2-pyridinyl)amino]-2-cyano-N-(5-hydroxynaphthalen-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108843158 |
| Molecular Formula | C19H13BrN4O2 |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | (Z)-3-[(5-bromo-2-pyridinyl)amino]-2-cyano-N-(5-hydroxynaphthalen-1-yl)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc(Br)cn1)C(=O)Nc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C19H13BrN4O2/c20-13-7-8-18(23-11-13)22-10-12(9-21)19(26)24-16-5-1-4-15-14(16)3-2-6-17(15)25/h1-8,10-11,25H,(H,22,23)(H,24,26)/b12-10- |
| InChIKey | BWSJKFMXNCLINA-BENRWUELSA-N |
| XLogP | 4.16 |
| TPSA | 98.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|