C15H12BrN5O — CID 108818266
(Z)-N-(4-aminophenyl)-3-[(5-bromo-2-pyridinyl)amino]-2-cyanoprop-2-enamide (PubChem CID 108818266) has the molecular formula C15H12BrN5O and a molecular weight of 358.20 g/mol. Its IUPAC name is (Z)-N-(4-aminophenyl)-3-[(5-bromo-2-pyridinyl)amino]-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-(4-aminophenyl)-3-[(5-bromo-2-pyridinyl)amino]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108818266 |
| Molecular Formula | C15H12BrN5O |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | (Z)-N-(4-aminophenyl)-3-[(5-bromo-2-pyridinyl)amino]-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc(Br)cn1)C(=O)Nc1ccc(N)cc1 |
| InChI | InChI=1S/C15H12BrN5O/c16-11-1-6-14(20-9-11)19-8-10(7-17)15(22)21-13-4-2-12(18)3-5-13/h1-6,8-9H,18H2,(H,19,20)(H,21,22)/b10-8- |
| InChIKey | CQBHZGPAARNHCA-NTMALXAHSA-N |
| XLogP | 2.88 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|