C17H15N5O2 — CID 108818677
(Z)-N-(4-acetamidophenyl)-2-cyano-3-(pyridin-2-ylamino)prop-2-enamide (PubChem CID 108818677) has the molecular formula C17H15N5O2 and a molecular weight of 321.34 g/mol. Its IUPAC name is (Z)-N-(4-acetamidophenyl)-2-cyano-3-(pyridin-2-ylamino)prop-2-enamide.
| Compound Name | (Z)-N-(4-acetamidophenyl)-2-cyano-3-(pyridin-2-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108818677 |
| Molecular Formula | C17H15N5O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | (Z)-N-(4-acetamidophenyl)-2-cyano-3-(pyridin-2-ylamino)prop-2-enamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)/C(C#N)=C\Nc2ccccn2)cc1 |
| InChI | InChI=1S/C17H15N5O2/c1-12(23)21-14-5-7-15(8-6-14)22-17(24)13(10-18)11-20-16-4-2-3-9-19-16/h2-9,11H,1H3,(H,19,20)(H,21,23)(H,22,24)/b13-11- |
| InChIKey | IPYWSLBYQVKVFF-QBFSEMIESA-N |
| XLogP | 2.50 |
| TPSA | 106.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|