C12H11N3O — CID 5458907
(Z)-2-(cyclopropanecarbonyl)-3-(pyridin-2-ylamino)prop-2-enenitrile (PubChem CID 5458907) has the molecular formula C12H11N3O and a molecular weight of 213.24 g/mol. Its IUPAC name is (Z)-2-(cyclopropanecarbonyl)-3-(pyridin-2-ylamino)prop-2-enenitrile.
| Compound Name | (Z)-2-(cyclopropanecarbonyl)-3-(pyridin-2-ylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 5458907 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | (Z)-2-(cyclopropanecarbonyl)-3-(pyridin-2-ylamino)prop-2-enenitrile |
| SMILES | N#C/C(=C/Nc1ccccn1)C(=O)C1CC1 |
| InChI | InChI=1S/C12H11N3O/c13-7-10(12(16)9-4-5-9)8-15-11-3-1-2-6-14-11/h1-3,6,8-9H,4-5H2,(H,14,15)/b10-8- |
| InChIKey | GUJHVNHITJUTSX-NTMALXAHSA-N |
| XLogP | 1.88 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|