C14H17N5O — CID 108831470
(Z)-2-cyano-N-cyclohexyl-3-(pyrimidin-2-ylamino)prop-2-enamide (PubChem CID 108831470) has the molecular formula C14H17N5O and a molecular weight of 271.32 g/mol. Its IUPAC name is (Z)-2-cyano-N-cyclohexyl-3-(pyrimidin-2-ylamino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-cyclohexyl-3-(pyrimidin-2-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108831470 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (Z)-2-cyano-N-cyclohexyl-3-(pyrimidin-2-ylamino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ncccn1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C14H17N5O/c15-9-11(10-18-14-16-7-4-8-17-14)13(20)19-12-5-2-1-3-6-12/h4,7-8,10,12H,1-3,5-6H2,(H,19,20)(H,16,17,18)/b11-10- |
| InChIKey | CBAHLMAMRLCBTR-KHPPLWFESA-N |
| XLogP | 1.74 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|