C14H18N4OS — CID 108831459
(Z)-2-cyano-N-cyclohexyl-3-[(4-methyl-1,3-thiazol-2-yl)amino]prop-2-enamide (PubChem CID 108831459) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is (Z)-2-cyano-N-cyclohexyl-3-[(4-methyl-1,3-thiazol-2-yl)amino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-cyclohexyl-3-[(4-methyl-1,3-thiazol-2-yl)amino]prop-2-enamide |
|---|---|
| PubChem CID | 108831459 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (Z)-2-cyano-N-cyclohexyl-3-[(4-methyl-1,3-thiazol-2-yl)amino]prop-2-enamide |
| SMILES | Cc1csc(N/C=C(/C#N)C(=O)NC2CCCCC2)n1 |
| InChI | InChI=1S/C14H18N4OS/c1-10-9-20-14(17-10)16-8-11(7-15)13(19)18-12-5-3-2-4-6-12/h8-9,12H,2-6H2,1H3,(H,16,17)(H,18,19)/b11-8- |
| InChIKey | SPLIJUYQWGPQNI-FLIBITNWSA-N |
| XLogP | 2.72 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|