C11H17N3OS — CID 4129191
1-cyclohexyl-3-(4-methyl-1,3-thiazol-2-yl)urea (PubChem CID 4129191) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is 1-cyclohexyl-3-(4-methyl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-cyclohexyl-3-(4-methyl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 4129191 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 1-cyclohexyl-3-(4-methyl-1,3-thiazol-2-yl)urea |
| SMILES | Cc1csc(NC(=O)NC2CCCCC2)n1 |
| InChI | InChI=1S/C11H17N3OS/c1-8-7-16-11(12-8)14-10(15)13-9-5-3-2-4-6-9/h7,9H,2-6H2,1H3,(H2,12,13,14,15) |
| InChIKey | LJPHGWXAEYWFII-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |