N-cyclohexyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen

C10H18N2S — CID 143290399

IUPACN-cyclohexyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen
SMILESCc1csc(NC2CCCCC2)n1.[H][H]
InChIInChI=1S/C10H16N2S.H2/c1-8-7-13-10(11-8)12-9-5-3-2-4-6-9;/h7,9H,2-6H2,1H3,(H,11,12);1H
InChIKeyQIZYQLDEVXCMBV-UHFFFAOYSA-N
MW198.33 g/mol
LogP3.44
Rot. Bonds2

About N-cyclohexyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen

N-cyclohexyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen (PubChem CID 143290399) has the molecular formula C10H18N2S and a molecular weight of 198.33 g/mol. Its IUPAC name is N-cyclohexyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen.

Molecular Properties

Compound NameN-cyclohexyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen
PubChem CID143290399
Molecular FormulaC10H18N2S
Molecular Weight198.33 g/mol
Exact Mass198.12
IUPAC NameN-cyclohexyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen
SMILESCc1csc(NC2CCCCC2)n1.[H][H]
InChIInChI=1S/C10H16N2S.H2/c1-8-7-13-10(11-8)12-9-5-3-2-4-6-9;/h7,9H,2-6H2,1H3,(H,11,12);1H
InChIKeyQIZYQLDEVXCMBV-UHFFFAOYSA-N
XLogP3.44
TPSA24.92 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.33
LogP ≤ 53.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze N-cyclohexyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-cyclohexyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen?
The IUPAC name of N-cyclohexyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen (CID 143290399) is N-cyclohexyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen.
What is the SMILES notation for N-cyclohexyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen?
The canonical SMILES for N-cyclohexyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen is Cc1csc(NC2CCCCC2)n1.[H][H].
What is the InChIKey of N-cyclohexyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen?
The InChIKey is QIZYQLDEVXCMBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2S.H2/c1-8-7-13-10(11-8)12-9-5-3-2-4-6-9;/h7,9H,2-6H2,1H3,(H,11,12);1H.
What are the key properties of N-cyclohexyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen?
N-cyclohexyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen has a molecular weight of 198.33 g/mol, XLogP of 3.44, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen is sourced from PubChem (CID 143290399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).