C13H22N2OS — CID 143608697
ethane;N-(4-methyl-1,3-thiazol-2-yl)cyclohexanecarboxamide (PubChem CID 143608697) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is ethane;N-(4-methyl-1,3-thiazol-2-yl)cyclohexanecarboxamide.
| Compound Name | ethane;N-(4-methyl-1,3-thiazol-2-yl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 143608697 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | ethane;N-(4-methyl-1,3-thiazol-2-yl)cyclohexanecarboxamide |
| SMILES | CC.Cc1csc(NC(=O)C2CCCCC2)n1 |
| InChI | InChI=1S/C11H16N2OS.C2H6/c1-8-7-15-11(12-8)13-10(14)9-5-3-2-4-6-9;1-2/h7,9H,2-6H2,1H3,(H,12,13,14);1-2H3 |
| InChIKey | UIQGNIOPSBCFNM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |