C9H13N3OS — CID 18072813
N-(4-methyl-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide (PubChem CID 18072813) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is N-(4-methyl-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | N-(4-methyl-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 18072813 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | N-(4-methyl-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
| SMILES | Cc1csc(NC(=O)C2CCCN2)n1 |
| InChI | InChI=1S/C9H13N3OS/c1-6-5-14-9(11-6)12-8(13)7-3-2-4-10-7/h5,7,10H,2-4H2,1H3,(H,11,12,13) |
| InChIKey | KGUZPWXLXTYGHE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |