C10H15N3OS — CID 60710833
N-(4,5-dimethyl-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide (PubChem CID 60710833) has the molecular formula C10H15N3OS and a molecular weight of 225.32 g/mol. Its IUPAC name is N-(4,5-dimethyl-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 60710833 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | N-(4,5-dimethyl-1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
| SMILES | Cc1nc(NC(=O)C2CCCN2)sc1C |
| InChI | InChI=1S/C10H15N3OS/c1-6-7(2)15-10(12-6)13-9(14)8-4-3-5-11-8/h8,11H,3-5H2,1-2H3,(H,12,13,14) |
| InChIKey | GOGBDKZRWGPHPH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |