C9H11N3O2S — CID 110689742
N-(4-methyl-1,3-thiazol-2-yl)-5-oxopyrrolidine-2-carboxamide (PubChem CID 110689742) has the molecular formula C9H11N3O2S and a molecular weight of 225.27 g/mol. Its IUPAC name is N-(4-methyl-1,3-thiazol-2-yl)-5-oxopyrrolidine-2-carboxamide.
| Compound Name | N-(4-methyl-1,3-thiazol-2-yl)-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110689742 |
| Molecular Formula | C9H11N3O2S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | N-(4-methyl-1,3-thiazol-2-yl)-5-oxopyrrolidine-2-carboxamide |
| SMILES | Cc1csc(NC(=O)C2CCC(=O)N2)n1 |
| InChI | InChI=1S/C9H11N3O2S/c1-5-4-15-9(10-5)12-8(14)6-2-3-7(13)11-6/h4,6H,2-3H2,1H3,(H,11,13)(H,10,12,14) |
| InChIKey | KOZLYFHRIAVSLE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |