N-cyclopentyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen

C9H16N2S — CID 142956868

IUPACN-cyclopentyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen
SMILESCc1csc(NC2CCCC2)n1.[H][H]
InChIInChI=1S/C9H14N2S.H2/c1-7-6-12-9(10-7)11-8-4-2-3-5-8;/h6,8H,2-5H2,1H3,(H,10,11);1H
InChIKeySADZRGSJGYHTDQ-UHFFFAOYSA-N
MW184.31 g/mol
LogP3.05
Rot. Bonds2

About N-cyclopentyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen

N-cyclopentyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen (PubChem CID 142956868) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is N-cyclopentyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen.

Molecular Properties

Compound NameN-cyclopentyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen
PubChem CID142956868
Molecular FormulaC9H16N2S
Molecular Weight184.31 g/mol
Exact Mass184.10
IUPAC NameN-cyclopentyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen
SMILESCc1csc(NC2CCCC2)n1.[H][H]
InChIInChI=1S/C9H14N2S.H2/c1-7-6-12-9(10-7)11-8-4-2-3-5-8;/h6,8H,2-5H2,1H3,(H,10,11);1H
InChIKeySADZRGSJGYHTDQ-UHFFFAOYSA-N
XLogP3.05
TPSA24.92 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.31
LogP ≤ 53.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze N-cyclopentyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-cyclopentyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen?
The IUPAC name of N-cyclopentyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen (CID 142956868) is N-cyclopentyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen.
What is the SMILES notation for N-cyclopentyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen?
The canonical SMILES for N-cyclopentyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen is Cc1csc(NC2CCCC2)n1.[H][H].
What is the InChIKey of N-cyclopentyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen?
The InChIKey is SADZRGSJGYHTDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2S.H2/c1-7-6-12-9(10-7)11-8-4-2-3-5-8;/h6,8H,2-5H2,1H3,(H,10,11);1H.
What are the key properties of N-cyclopentyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen?
N-cyclopentyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen has a molecular weight of 184.31 g/mol, XLogP of 3.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-4-methyl-1,3-thiazol-2-amine;molecular hydrogen is sourced from PubChem (CID 142956868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).