C11H15N3O3S — CID 28858154
2-(cyclohexylcarbamoylamino)-1,3-thiazole-4-carboxylic acid (PubChem CID 28858154) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is 2-(cyclohexylcarbamoylamino)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(cyclohexylcarbamoylamino)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 28858154 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 2-(cyclohexylcarbamoylamino)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(Nc1nc(C(=O)O)cs1)NC1CCCCC1 |
| InChI | InChI=1S/C11H15N3O3S/c15-9(16)8-6-18-11(13-8)14-10(17)12-7-4-2-1-3-5-7/h6-7H,1-5H2,(H,15,16)(H2,12,13,14,17) |
| InChIKey | AYWCZARDFZQDSR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |