C10H14N2O4S2 — CID 90044718
2-(cyclohexylsulfamoyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 90044718) has the molecular formula C10H14N2O4S2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-(cyclohexylsulfamoyl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(cyclohexylsulfamoyl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 90044718 |
| Molecular Formula | C10H14N2O4S2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 2-(cyclohexylsulfamoyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(S(=O)(=O)NC2CCCCC2)n1 |
| InChI | InChI=1S/C10H14N2O4S2/c13-9(14)8-6-17-10(11-8)18(15,16)12-7-4-2-1-3-5-7/h6-7,12H,1-5H2,(H,13,14) |
| InChIKey | VSZUSIPLBKNGNS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |