C13H19N3OS — CID 71702866
azepan-1-yl-[2-(cyclopropylamino)-1,3-thiazol-4-yl]methanone (PubChem CID 71702866) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is azepan-1-yl-[2-(cyclopropylamino)-1,3-thiazol-4-yl]methanone.
| Compound Name | azepan-1-yl-[2-(cyclopropylamino)-1,3-thiazol-4-yl]methanone |
|---|---|
| PubChem CID | 71702866 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | azepan-1-yl-[2-(cyclopropylamino)-1,3-thiazol-4-yl]methanone |
| SMILES | O=C(c1csc(NC2CC2)n1)N1CCCCCC1 |
| InChI | InChI=1S/C13H19N3OS/c17-12(16-7-3-1-2-4-8-16)11-9-18-13(15-11)14-10-5-6-10/h9-10H,1-8H2,(H,14,15) |
| InChIKey | NZEJVQJOLVAIBI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |