C17H17Cl2N3O2S — CID 46113813
N-[4-(azepane-1-carbonyl)-1,3-thiazol-2-yl]-3,4-dichlorobenzamide (PubChem CID 46113813) has the molecular formula C17H17Cl2N3O2S and a molecular weight of 398.32 g/mol. Its IUPAC name is N-[4-(azepane-1-carbonyl)-1,3-thiazol-2-yl]-3,4-dichlorobenzamide.
| Compound Name | N-[4-(azepane-1-carbonyl)-1,3-thiazol-2-yl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 46113813 |
| Molecular Formula | C17H17Cl2N3O2S |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | N-[4-(azepane-1-carbonyl)-1,3-thiazol-2-yl]-3,4-dichlorobenzamide |
| SMILES | O=C(Nc1nc(C(=O)N2CCCCCC2)cs1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H17Cl2N3O2S/c18-12-6-5-11(9-13(12)19)15(23)21-17-20-14(10-25-17)16(24)22-7-3-1-2-4-8-22/h5-6,9-10H,1-4,7-8H2,(H,20,21,23) |
| InChIKey | NCAYTBXUIXGZGT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |