C18H20Cl2N4O2S — CID 46113825
2-[(3,4-dichlorobenzoyl)amino]-N-(3-pyrrolidin-1-ylpropyl)-1,3-thiazole-4-carboxamide (PubChem CID 46113825) has the molecular formula C18H20Cl2N4O2S and a molecular weight of 427.36 g/mol. Its IUPAC name is 2-[(3,4-dichlorobenzoyl)amino]-N-(3-pyrrolidin-1-ylpropyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(3,4-dichlorobenzoyl)amino]-N-(3-pyrrolidin-1-ylpropyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 46113825 |
| Molecular Formula | C18H20Cl2N4O2S |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 2-[(3,4-dichlorobenzoyl)amino]-N-(3-pyrrolidin-1-ylpropyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1nc(C(=O)NCCCN2CCCC2)cs1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H20Cl2N4O2S/c19-13-5-4-12(10-14(13)20)16(25)23-18-22-15(11-27-18)17(26)21-6-3-9-24-7-1-2-8-24/h4-5,10-11H,1-3,6-9H2,(H,21,26)(H,22,23,25) |
| InChIKey | ZFTDGPGBPZSXHF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|