C24H28Cl4N4O2 — CID 3672547
3,4-dichloro-N-[3-[4-[3-[(3,4-dichlorobenzoyl)amino]propyl]piperazin-1-yl]propyl]benzamide (PubChem CID 3672547) has the molecular formula C24H28Cl4N4O2 and a molecular weight of 546.33 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-[4-[3-[(3,4-dichlorobenzoyl)amino]propyl]piperazin-1-yl]propyl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-[4-[3-[(3,4-dichlorobenzoyl)amino]propyl]piperazin-1-yl]propyl]benzamide |
|---|---|
| PubChem CID | 3672547 |
| Molecular Formula | C24H28Cl4N4O2 |
| Molecular Weight | 546.33 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | 3,4-dichloro-N-[3-[4-[3-[(3,4-dichlorobenzoyl)amino]propyl]piperazin-1-yl]propyl]benzamide |
| SMILES | O=C(NCCCN1CCN(CCCNC(=O)c2ccc(Cl)c(Cl)c2)CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H28Cl4N4O2/c25-19-5-3-17(15-21(19)27)23(33)29-7-1-9-31-11-13-32(14-12-31)10-2-8-30-24(34)18-4-6-20(26)22(28)16-18/h3-6,15-16H,1-2,7-14H2,(H,29,33)(H,30,34) |
| InChIKey | MBDLXBJBJHPIAA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.33 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|