C13H16Cl2N2O2 — CID 110358538
N-(4-acetamidobutyl)-3,4-dichlorobenzamide (PubChem CID 110358538) has the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.19 g/mol. Its IUPAC name is N-(4-acetamidobutyl)-3,4-dichlorobenzamide.
| Compound Name | N-(4-acetamidobutyl)-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 110358538 |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N-(4-acetamidobutyl)-3,4-dichlorobenzamide |
| SMILES | CC(=O)NCCCCNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H16Cl2N2O2/c1-9(18)16-6-2-3-7-17-13(19)10-4-5-11(14)12(15)8-10/h4-5,8H,2-3,6-7H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | FSZBNEHJVVQBSK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|