C14H20Cl2N2OS2 — CID 154613272
3,4-dichloro-N-[3-[2-(dimethylamino)ethyldisulfanyl]propyl]benzamide (PubChem CID 154613272) has the molecular formula C14H20Cl2N2OS2 and a molecular weight of 367.37 g/mol. Its IUPAC name is 3,4-dichloro-N-[3-[2-(dimethylamino)ethyldisulfanyl]propyl]benzamide.
| Compound Name | 3,4-dichloro-N-[3-[2-(dimethylamino)ethyldisulfanyl]propyl]benzamide |
|---|---|
| PubChem CID | 154613272 |
| Molecular Formula | C14H20Cl2N2OS2 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 3,4-dichloro-N-[3-[2-(dimethylamino)ethyldisulfanyl]propyl]benzamide |
| SMILES | CN(C)CCSSCCCNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H20Cl2N2OS2/c1-18(2)7-9-21-20-8-3-6-17-14(19)11-4-5-12(15)13(16)10-11/h4-5,10H,3,6-9H2,1-2H3,(H,17,19) |
| InChIKey | XIEDGYFPFZWEOJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|