C14H18Cl2N2O2 — CID 113051988
N-[2-[acetyl(propan-2-yl)amino]ethyl]-3,4-dichlorobenzamide (PubChem CID 113051988) has the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.22 g/mol. Its IUPAC name is N-[2-[acetyl(propan-2-yl)amino]ethyl]-3,4-dichlorobenzamide.
| Compound Name | N-[2-[acetyl(propan-2-yl)amino]ethyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 113051988 |
| Molecular Formula | C14H18Cl2N2O2 |
| Molecular Weight | 317.22 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | N-[2-[acetyl(propan-2-yl)amino]ethyl]-3,4-dichlorobenzamide |
| SMILES | CC(=O)N(CCNC(=O)c1ccc(Cl)c(Cl)c1)C(C)C |
| InChI | InChI=1S/C14H18Cl2N2O2/c1-9(2)18(10(3)19)7-6-17-14(20)11-4-5-12(15)13(16)8-11/h4-5,8-9H,6-7H2,1-3H3,(H,17,20) |
| InChIKey | YPZPFBIETKWHPK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |