C16H20Cl2N2O5 — CID 22143949
2-[carboxy-[2-[(3,4-dichlorobenzoyl)amino]ethyl]amino]-4-methylpentanoic acid (PubChem CID 22143949) has the molecular formula C16H20Cl2N2O5 and a molecular weight of 391.25 g/mol. Its IUPAC name is 2-[carboxy-[2-[(3,4-dichlorobenzoyl)amino]ethyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[carboxy-[2-[(3,4-dichlorobenzoyl)amino]ethyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 22143949 |
| Molecular Formula | C16H20Cl2N2O5 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 2-[carboxy-[2-[(3,4-dichlorobenzoyl)amino]ethyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(C(=O)O)N(CCNC(=O)c1ccc(Cl)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C16H20Cl2N2O5/c1-9(2)7-13(15(22)23)20(16(24)25)6-5-19-14(21)10-3-4-11(17)12(18)8-10/h3-4,8-9,13H,5-7H2,1-2H3,(H,19,21)(H,22,23)(H,24,25) |
| InChIKey | IVLJAJXBEBCNLH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |